53554-30-6 Usage
General Description
5-Pyrimidinecarboxamide,2,4-dimethyl-(6CI,9CI) is a chemical compound with the molecular formula C7H10N4O. It is a derivative of pyrimidine and has two methyl groups attached to the 2 and 4 positions of the pyrimidine ring. 5-Pyrimidinecarboxamide,2,4-dimethyl-(6CI,9CI) is commonly used in the synthesis of pharmaceuticals and agrochemicals due to its versatile reactivity and structural properties. It is also utilized in various industrial processes such as the production of dyes, pigments, and organic intermediates. Additionally, this chemical may have potential applications in the field of medicinal chemistry, making it a valuable building block for the development of new drugs and therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 53554-30-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,5,5 and 4 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 53554-30:
(7*5)+(6*3)+(5*5)+(4*5)+(3*4)+(2*3)+(1*0)=116
116 % 10 = 6
So 53554-30-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H9N3O/c1-4-6(7(8)11)3-9-5(2)10-4/h3H,1-2H3,(H2,8,11)
