53574-58-6 Usage
Uses
Used in Pharmaceutical Industry:
2-Pyridinecarboxylic acid,5-formyl-(9CI) is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure, which includes a pyridine ring and a formyl group, allows it to be a key component in the development of new drugs with potential therapeutic applications.
Used in Chemical Research:
2-Pyridinecarboxylic acid,5-formyl-(9CI) is used as a research compound in the field of organic chemistry. Its properties and reactivity can be studied to gain insights into the behavior of similar compounds and to develop new synthetic methods or applications.
Used in Material Science:
2-Pyridinecarboxylic acid,5-formyl-(9CI) may be used as a building block in the development of new materials with specific properties, such as conductivity, stability, or catalytic activity. Its incorporation into polymers or other materials could lead to innovative applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 53574-58-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,5,7 and 4 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 53574-58:
(7*5)+(6*3)+(5*5)+(4*7)+(3*4)+(2*5)+(1*8)=136
136 % 10 = 6
So 53574-58-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H5NO3/c9-4-5-1-2-6(7(10)11)8-3-5/h1-4H,(H,10,11)
