535934-25-9 Usage
Uses
Used in Chemical Research:
4-Bromo-3-Chloroiodobenzene is used as a chemical intermediate for [facilitating the synthesis of various organic compounds] in chemical research. Its unique halogenated structure allows for the creation of a wide range of derivatives, making it a valuable component in the development of new chemical entities.
Used in Organic Synthesis:
In the field of organic synthesis, 4-Bromo-3-Chloroiodobenzene is used as a starting material for [the preparation of complex organic molecules]. Its presence of multiple halogens enables various reaction pathways, such as substitution, addition, and coupling reactions, which are crucial for constructing complex molecular structures.
Used in Pharmaceutical Development:
4-Bromo-3-Chloroiodobenzene is used as a building block in the pharmaceutical industry for [the synthesis of potential drug candidates]. Its structural diversity and reactivity make it a key component in the design and synthesis of new therapeutic agents, potentially leading to the discovery of novel medications.
Used in Material Science:
In material science, 4-Bromo-3-Chloroiodobenzene is used as a precursor for [the development of advanced materials]. Its halogenated nature can contribute to the creation of materials with unique electronic, optical, or mechanical properties, which can be applied in various high-tech applications, such as sensors, solar cells, or electronic devices.
Check Digit Verification of cas no
The CAS Registry Mumber 535934-25-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,3,5,9,3 and 4 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 535934-25:
(8*5)+(7*3)+(6*5)+(5*9)+(4*3)+(3*4)+(2*2)+(1*5)=169
169 % 10 = 9
So 535934-25-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H3BrClI/c7-5-2-1-4(9)3-6(5)8/h1-3H
