53636-68-3 Usage
Uses
Used in Organic Synthesis:
3-amino-5-chloropyridine-2-carboxylic acid is used as a key intermediate in organic synthesis for the preparation of various complex organic molecules. Its unique structure and functional groups allow for multiple reaction pathways, facilitating the synthesis of a wide range of compounds.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-amino-5-chloropyridine-2-carboxylic acid is used as a building block for the development of new drugs. Its versatile structure and functional groups can be utilized to create novel drug candidates with potential therapeutic applications.
Used in Materials Science:
3-amino-5-chloropyridine-2-carboxylic acid is used in materials science for the development of new materials with specific properties. Its unique structure and functional groups can be exploited to design materials with tailored characteristics for various applications, such as sensors, catalysts, or advanced materials with specific mechanical, electrical, or optical properties.
Further research and exploration of the properties and potential applications of 3-amino-5-chloropyridine-2-carboxylic acid may reveal its full range of uses and significance in various fields, expanding its utility and impact on scientific and industrial advancements.
Check Digit Verification of cas no
The CAS Registry Mumber 53636-68-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,6,3 and 6 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 53636-68:
(7*5)+(6*3)+(5*6)+(4*3)+(3*6)+(2*6)+(1*8)=133
133 % 10 = 3
So 53636-68-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H5ClN2O2/c7-3-1-4(8)5(6(10)11)9-2-3/h1-2H,8H2,(H,10,11)
53636-68-3Relevant academic research and scientific papers
COMPOUNDS AND METHODS FOR TREATING DYSLIPIDEMIA
-
Page/Page column 58, (2008/06/13)
The present invention discloses compounds of formula I wherein A, n, m, j, q, K, W, X, K, Z, R1, R2, R3, R4, R5, and R6 are as defined herein and their pharmaceutical compositions and methods of use are disclosed as useful for treating dyslipidemia and its sequelae.
