53641-17-1 Usage
Uses
Used in Pharmaceutical Industry:
3-Ethylbenzo[d]thiazol-2(3H)-iMine is used as a pharmaceutical intermediate for the synthesis of various therapeutic agents. Its unique structure allows it to be a promising candidate in the development of new drugs, particularly in the areas of medicinal chemistry and drug discovery.
Used in Chemical Research:
In the field of chemical research, 3-Ethylbenzo[d]thiazol-2(3H)-iMine serves as a valuable compound for studying the properties and reactions of thiazole-based compounds. Its unique structure provides opportunities for exploring new chemical pathways and understanding the reactivity of related compounds.
Used in Material Science:
3-Ethylbenzo[d]thiazol-2(3H)-iMine may also find applications in material science, particularly in the development of new materials with specific properties. Its unique structure could contribute to the creation of materials with tailored characteristics for use in various applications, such as sensors, catalysts, or advanced materials for electronics and energy storage.
Check Digit Verification of cas no
The CAS Registry Mumber 53641-17-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,6,4 and 1 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 53641-17:
(7*5)+(6*3)+(5*6)+(4*4)+(3*1)+(2*1)+(1*7)=111
111 % 10 = 1
So 53641-17-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H12N2S/c1-2-11(9(10)12)8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H2,10,12)
53641-17-1Relevant academic research and scientific papers
151. Azidinium-Salze. 24. Mitteilung. Thermolyse heterocyclischer Azidinium-tetrafluoroborate
Huys-Francotte, Martine,Balli, Heinz
, p. 1679 - 1684 (2007/10/02)
The thermolysis of some azidinium salts was investigated.It led to a large variety of products which were isolated or identified by GC/MS.Reaction mechanisms are discussed to explain the product formation.
