53646-01-8 Usage
Uses
Used in Pharmaceutical Industry:
(1-chloropropan-2-ylideneamino)urea is used as an intermediate in the synthesis of various biologically active compounds, playing a crucial role in the development of pharmaceutical products.
Used in Agrochemical Industry:
Similarly, in the agrochemical sector, (1-chloropropan-2-ylideneamino)urea serves as an intermediate, contributing to the creation of substances that help in the management and protection of crops.
Used in Materials Science:
(1-chloropropan-2-ylideneamino)urea may also find applications in the field of materials science, where its unique properties could be leveraged to develop new materials with specific characteristics.
Used in Organic Chemistry:
Its potential uses extend to the realm of organic chemistry, where it could be key in the synthesis of a range of organic compounds for various purposes.
Used in Medicinal Chemistry:
Furthermore, (1-chloropropan-2-ylideneamino)urea holds promise in medicinal chemistry for the development of novel drug molecules, potentially leading to advancements in healthcare.
Check Digit Verification of cas no
The CAS Registry Mumber 53646-01-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,6,4 and 6 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 53646-01:
(7*5)+(6*3)+(5*6)+(4*4)+(3*6)+(2*0)+(1*1)=118
118 % 10 = 8
So 53646-01-8 is a valid CAS Registry Number.
InChI:InChI=1/C4H8ClN3O/c1-3(2-5)7-8-4(6)9/h2H2,1H3,(H3,6,8,9)/b7-3+
