536693-97-7 Usage
Uses
Used in Pharmaceutical Industry:
2,5-Dichloropyridine-3-boronic Acid is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure and properties make it a valuable building block for the development of new drugs with potential therapeutic applications.
Used in Organic Synthesis:
In the field of organic synthesis, 2,5-Dichloropyridine-3-boronic Acid is employed as a versatile reagent for the preparation of a wide range of organic compounds. Its boronic acid group allows for various chemical reactions, such as coupling reactions, which are essential for the synthesis of complex molecules.
Used in Medicinal Chemistry:
2,5-Dichloropyridine-3-boronic Acid is used as a starting material for the design and synthesis of new boronic acid-based drugs. Its presence in the structure of these compounds can impart unique biological activities, such as antifungal, antibacterial, or enzyme inhibitory properties, making it a valuable tool in the development of novel therapeutic agents.
Used in Chemical Research:
2,5-Dichloropyridine-3-boronic Acid is also utilized in chemical research to study the properties and reactivity of boronic acids. This knowledge can be applied to the development of new synthetic methods, as well as to understand the underlying mechanisms of various chemical reactions involving boronic acids.
Check Digit Verification of cas no
The CAS Registry Mumber 536693-97-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,3,6,6,9 and 3 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 536693-97:
(8*5)+(7*3)+(6*6)+(5*6)+(4*9)+(3*3)+(2*9)+(1*7)=197
197 % 10 = 7
So 536693-97-7 is a valid CAS Registry Number.
InChI:InChI=1/C5H4BCl2NO2/c7-3-1-4(6(10)11)5(8)9-2-3/h1-2,10-11H
536693-97-7Relevant academic research and scientific papers
DIHYDROXY(3-PYRIDYL)BORANE COMPOUNDS
-
Page 6, (2010/02/08)
A dihydroxy(3-pyridyl)borane compound of the formula (1): wherein R1 represents a hydrogen atom, halogen atom or alkoxycarbonylamino group; R2 represents a hydrogen atom, halogen atom, alkyl group or fluoroalkyl group; with the proviso that the case wherein both R1 and R2 are hydrogen atoms is excepted.
