5368-70-7 Usage
Uses
Used in Pharmaceutical Synthesis:
3,4-Bis(chloromethyl)-2,5-dimethylthiophene is used as a key intermediate in the synthesis of pharmaceuticals due to its ability to facilitate the introduction of various functional groups into drug molecules. This enhances the compound's potential for creating new drugs with improved therapeutic properties.
Used in Agrochemical Production:
In the agrochemical industry, 3,4-bis(chloromethyl)-2,5-dimethylthiophene serves as a precursor for the development of new agrochemicals. Its reactivity and structural features enable the creation of compounds with specific pesticidal or herbicidal properties, contributing to more effective crop protection strategies.
Used in Polymer and Dye Synthesis:
3,4-Bis(chloromethyl)-2,5-dimethylthiophene is also utilized as a precursor in the production of polymers and dyes. Its unique chemical structure allows for the creation of polymers with tailored properties, such as improved strength or specific optical characteristics. Similarly, its use in dye synthesis can lead to the development of dyes with novel color characteristics or application-specific performance.
Used in Material Science:
3,4-BIS(CHLOROMETHYL)-2,5-DIMETHYLTHIOPHENE's reactivity and structural attributes make it a valuable building block in material science, where it can be used to develop new materials with specific properties required for various applications, such as high-performance plastics or advanced composites.
Check Digit Verification of cas no
The CAS Registry Mumber 5368-70-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,3,6 and 8 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 5368-70:
(6*5)+(5*3)+(4*6)+(3*8)+(2*7)+(1*0)=107
107 % 10 = 7
So 5368-70-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H10Cl2S/c1-5-7(3-9)8(4-10)6(2)11-5/h3-4H2,1-2H3
