5382-88-7 Usage
Uses
Used in Pharmaceutical Industry:
[(Acetylamino)oxy]acetic acid is used as a pharmaceutical intermediate for its role in the synthesis of various drugs. Its presence in the production process aids in the creation of a wide range of medications that target different health conditions.
Used in Organic Synthesis:
[(Acetylamino)oxy]acetic acid is used as a building block in organic synthesis for its ability to form essential components in the development of new organic compounds. This contributes to the advancement of chemical research and the creation of novel substances with potential applications in various industries.
Used in Agrochemical Production:
[(Acetylamino)oxy]acetic acid is used in the production of agrochemicals for its contribution to the development of substances that can enhance agricultural productivity and protect crops from pests and diseases.
Used in Industrial Chemical Production:
[(Acetylamino)oxy]acetic acid is used in the production of other industrial chemicals for its role in creating compounds that serve various purposes in different sectors, such as manufacturing, construction, and textiles.
Additionally, due to its anti-inflammatory and neuroprotective properties, [(Acetylamino)oxy]acetic acid is being researched for potential applications in the treatment of various medical conditions, which could further expand its uses in the healthcare industry.
Check Digit Verification of cas no
The CAS Registry Mumber 5382-88-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,3,8 and 2 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 5382-88:
(6*5)+(5*3)+(4*8)+(3*2)+(2*8)+(1*8)=107
107 % 10 = 7
So 5382-88-7 is a valid CAS Registry Number.
InChI:InChI=1/C4H7NO4/c1-3(6)5-9-2-4(7)8/h2H2,1H3,(H,5,6)(H,7,8)