53826-01-0 Usage
Common Uses
Fluorescent indicator and dye
Widely used in various applications for the detection and measurement of substances due to its fluorescent properties.
Solubility
Soluble in water
The compound can dissolve in water, making it suitable for use in aqueous solutions and various chemical reactions.
Application in Analytical Chemistry
Detection and measurement of substances
2,8-Dimethylquinoline hydrochloride is used as a tool in analytical chemistry for identifying and quantifying different substances.
Industrial Use
Stabilizer and corrosion inhibitor
The compound serves as a stabilizer and corrosion inhibitor in various industrial applications, protecting materials from degradation and wear.
Antimicrobial Properties
Known for its antimicrobial activity
2,8-Dimethylquinoline hydrochloride exhibits antimicrobial properties, making it effective against various microorganisms.
Check Digit Verification of cas no
The CAS Registry Mumber 53826-01-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,8,2 and 6 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 53826-01:
(7*5)+(6*3)+(5*8)+(4*2)+(3*6)+(2*0)+(1*1)=120
120 % 10 = 0
So 53826-01-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H11N.ClH/c1-8-4-3-5-10-7-6-9(2)12-11(8)10;/h3-7H,1-2H3;1H
