538342-98-2 Usage
Uses
Used in Pharmaceutical Industry:
4-PROPYLBENZYLAMINE is used as a chemical intermediate for the synthesis of various pharmaceuticals. Its unique structure allows it to be incorporated into the development of new drugs, potentially leading to the creation of novel therapeutic agents.
Used in Agrochemical Industry:
In the agrochemical sector, 4-PROPYLBENZYLAMINE is utilized as an intermediate in the production of various agrochemicals. Its properties make it suitable for the synthesis of compounds that can be used in the development of pesticides, herbicides, and other agricultural chemicals to improve crop yield and protect plants from pests.
Used in Chemical Research:
4-PROPYLBENZYLAMINE is also used in chemical research as a starting material for the synthesis of various organic compounds. Its reactivity and structural features make it a valuable compound for exploring new chemical reactions and developing innovative synthetic pathways.
Check Digit Verification of cas no
The CAS Registry Mumber 538342-98-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,3,8,3,4 and 2 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 538342-98:
(8*5)+(7*3)+(6*8)+(5*3)+(4*4)+(3*2)+(2*9)+(1*8)=172
172 % 10 = 2
So 538342-98-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H15N/c1-2-3-9-4-6-10(8-11)7-5-9/h4-7H,2-3,8,11H2,1H3
