5388-28-3 Usage
Description
S-Benzylisothiourea hydrochloride is a chemical compound that belongs to the class of isothioureas. It is commonly used as a reagent in organic synthesis, particularly in the preparation of heterocyclic compounds and pharmaceuticals. S-BENZYLISOTHIOUREA HYDROCHLORIDE has a wide range of applications, including as an intermediate in the synthesis of various biologically active compounds. It is also used as a catalyst in certain chemical reactions and as a ligand in coordination chemistry. Additionally, S-Benzylisothiourea hydrochloride has potential biomedical applications, such as in the treatment of cancer and other diseases. Overall, this compound plays a crucial role in the field of organic chemistry and has significant potential for various industrial and research applications.
Uses
Used in Organic Synthesis:
S-Benzylisothiourea hydrochloride is used as a reagent for the preparation of heterocyclic compounds and pharmaceuticals, contributing to the development of new drugs and chemical compounds.
Used as an Intermediate:
S-Benzylisothiourea hydrochloride is used as an intermediate in the synthesis of various biologically active compounds, facilitating the creation of molecules with potential therapeutic properties.
Used as a Catalyst:
In certain chemical reactions, S-Benzylisothiourea hydrochloride is used as a catalyst to increase the rate of reaction and improve the efficiency of the process.
Used as a Ligand:
S-Benzylisothiourea hydrochloride is utilized as a ligand in coordination chemistry, playing a role in the formation of coordination compounds and influencing their properties.
Used in Biomedical Applications:
S-Benzylisothiourea hydrochloride has potential applications in the treatment of cancer and other diseases, offering a promising avenue for research and development in the medical field.
Check Digit Verification of cas no
The CAS Registry Mumber 5388-28-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,3,8 and 8 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 5388-28:
(6*5)+(5*3)+(4*8)+(3*8)+(2*2)+(1*8)=113
113 % 10 = 3
So 5388-28-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N4/c1-8-6-9-3-5(2-7)4-10-6/h3-4H,1H3,(H,8,9,10)