5391-75-3 Usage
Uses
Used in Medicinal Chemistry Research and Development:
(1,4-dihydroxynaphthalen-2-yl)sulfanylmethanimidamide is used as a research compound for exploring its potential in the field of medicinal chemistry. Its unique structure and properties make it a valuable building block for the synthesis of pharmaceuticals and the development of new drugs and therapeutic compounds.
Used in Pharmaceutical Synthesis:
In the pharmaceutical industry, (1,4-dihydroxynaphthalen-2-yl)sulfanylmethanimidamide is used as a key intermediate in the synthesis of various drugs and therapeutic agents. Its specific properties and reactivity contribute to the creation of novel and effective medications.
Used in Drug Development:
(1,4-dihydroxynaphthalen-2-yl)sulfanylmethanimidamide serves as a building block in the development of new drugs and therapeutic compounds. Its potential applications in medicinal chemistry allow researchers to explore its use in creating innovative treatments for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 5391-75-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,3,9 and 1 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 5391-75:
(6*5)+(5*3)+(4*9)+(3*1)+(2*7)+(1*5)=103
103 % 10 = 3
So 5391-75-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H10N2O2S/c12-11(13)16-9-5-8(14)6-3-1-2-4-7(6)10(9)15/h1-5,14-15H,(H3,12,13)
