53944-40-4

Usage

InChI:InChI=1/C14H9NO3/c1-8(16)9-4-5-12-11(7-9)13(17)10-3-2-6-15-14(10)18-12/h2-7H,1H3

Upstream product

• 53944-29-9 1-(5H-chromeno[2,3-b]pyridin-7-yl)-ethanone 

Relevant academic research and scientific papers

Distillate fuel and/or lubricant base oil of hydrocarbon range to optimize a Fischer-Tropsch synthesis method

Methods for converting of syngas to higher molecular weight products using Fischer-Tropsch synthesis, and methods for optimizing the catalyst systems in the synthesis, are disclosed. In one embodiment, the methods use cobalt/ruthenium Fischer-Tropsch catalysts in combination with an olefin isomerization catalyst, which isomerizes double bonds in C4+ olefins as they are formed. In another embodiment, the methods use Fischer-Tropsch catalysts that may or may not be cobalt/ruthenium catalysts, in combination with olefin isomerization catalysts which are acidic enough to isomerize the C4+ olefins but not too acidic to cause rapid coking. A benefit of using the relatively less acidic zeolites is that the ratio of iso-paraffins to aromatics is increased relative to when more acidic zeolites are used. Also, the relatively less acidic zeolites do not coke as readily as the relatively more acidic zeolites. The methods can advantageously be optimized using combinatorial chemistry, in which a database of combinations of catalyst systems and, optionally, reaction conditions, which provide various product streams, are generated. As market conditions vary and/or product requirements change, conditions suitable for forming desired products can be identified with little or no downtime.

Benzopyrano and benzothiopyrano [2,3-6] pyridines

Heterocyclic compounds of the formula: SPC1 Wherein A is a carbonyl group, a methylene group or an alkylidene group having 2 to 4 carbon atoms; B is an oxygen atom, a sulfur atom or --N(R')-- (wherein R' is a hydrogen atom or an alkyl group having 1 to 4 carbon atoms); each of R1 and R2 is a hydrogen atom, a halogen atom, an alkyl group having 1 to 4 carbon atoms, an alkoxy group having 1 to 4 carbon atoms or a phenyl group which may be substituted by a halogen atom, an alkyl group having 1 to 4 carbon atoms or an alkoxy group having 1 to 4 carbon atoms; X is an alkyl group having 1 to 4 carbon atoms, a cycloalkyl group having 3 to 6 carbon atoms or OM (wherein M is a hydrogen atom, an alkyl group having 1 to 4 carbon atoms, a metal atom or NH4); and ring P represents a pyridine ring, are useful as anti-allergic agents.