54002-32-3 Usage
Uses
Used in Organic Synthesis:
5-(Acetylamino)-3-bromo-2-nitro-benzoic acid is used as a building block for the synthesis of more complex organic molecules. Its unique structure and functional groups make it a valuable component in the creation of various organic compounds.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 5-(Acetylamino)-3-bromo-2-nitro-benzoic acid is used as a starting material or intermediate in the development of new drugs. Its potential biological activities and versatile chemical properties allow researchers to explore its applications in the treatment of various diseases and conditions.
Used in Chemical Reactions:
5-(Acetylamino)-3-bromo-2-nitro-benzoic acid can be employed in various chemical reactions, such as substitution, addition, or elimination reactions, to modify its structure and properties. This allows chemists to create new derivatives with specific characteristics for different applications.
Used in Analytical Chemistry:
5-(ACETYLAMINO)-3-BROMO-2-NITRO-BENZOIC ACID can also be utilized in analytical chemistry for the development of new methods or techniques for the detection, quantification, or analysis of other compounds. Its unique structure and properties can contribute to the advancement of analytical methods in various fields.
Used in Material Science:
5-(Acetylamino)-3-bromo-2-nitro-benzoic acid may find applications in material science, where its chemical properties can be exploited to develop new materials with specific characteristics, such as improved stability, reactivity, or selectivity. This can lead to the creation of innovative materials for various industries, including electronics, coatings, or adhesives.
Check Digit Verification of cas no
The CAS Registry Mumber 54002-32-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,4,0,0 and 2 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 54002-32:
(7*5)+(6*4)+(5*0)+(4*0)+(3*2)+(2*3)+(1*2)=73
73 % 10 = 3
So 54002-32-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H7BrN2O5/c1-4(13)11-5-2-6(9(14)15)8(12(16)17)7(10)3-5/h2-3H,1H3,(H,11,13)(H,14,15)
54002-32-3Relevant academic research and scientific papers
PRODUCTS FROM NITRATION OF 3,5-SUBSTITUTED BENZOIC ACIDS
Nekhoroshev, A. A.,Sevbo, D. P.,Ginzburg, O. A.
, p. 313 - 317 (2007/10/02)
During the nitration of 3,5-substituted benzoic acids by a nitrating mixture one isomer is formed if one of the substituents is an acetylamino group.
