54013-06-8 Usage
Uses
Used in Pharmaceutical Industry:
Ethyl 5-amino-2-pyrazinecarboxylate is used as a pharmaceutical intermediate for its crucial role in the preparation of complex biologically active molecules and pharmaceuticals. Its unique chemical structure and properties make it a valuable component in the development of new drugs and therapeutic agents.
Used in Organic Chemistry Research:
In the field of organic chemistry, Ethyl 5-amino-2-pyrazinecarboxylate is used as a research compound to explore its potential reactions and transformations. Its ester and carboxylic acid properties provide a foundation for various chemical reactions, contributing to the advancement of organic chemistry knowledge and techniques.
Used in Drug Development:
Ethyl 5-amino-2-pyrazinecarboxylate is employed as a key component in drug development, where its unique structure and reactivity can be leveraged to create novel pharmaceuticals with specific therapeutic effects. Its versatility as a building block in the synthesis of complex molecules makes it an essential tool in the design and creation of new drugs.
Used in Biochemical Studies:
In biochemical research, Ethyl 5-amino-2-pyrazinecarboxylate is utilized to study its interactions with biological systems and macromolecules. Its potential to form various complexes and participate in biochemical reactions can provide insights into the mechanisms of action of certain biological processes and the development of targeted therapies.
Overall, Ethyl 5-amino-2-pyrazinecarboxylate is a versatile and valuable compound in various scientific and industrial applications, particularly in the pharmaceutical and chemical research fields, where its unique properties and reactivity contribute to the advancement of knowledge and the development of innovative solutions.
Check Digit Verification of cas no
The CAS Registry Mumber 54013-06-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,4,0,1 and 3 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 54013-06:
(7*5)+(6*4)+(5*0)+(4*1)+(3*3)+(2*0)+(1*6)=78
78 % 10 = 8
So 54013-06-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H9N3O2/c1-2-12-7(11)5-3-10-6(8)4-9-5/h3-4H,2H2,1H3,(H2,8,10)
