5407-52-3 Usage
Uses
Used in Dye Synthesis:
P-ANISIDINE, 2-CHLORO-, HYDROCHLORIDE is used as a dye intermediate for the synthesis of various dyes. Its enhanced reactivity due to the chlorine atom allows for the creation of a wide range of dyes with different properties and applications.
Used in Pharmaceutical Synthesis:
P-ANISIDINE, 2-CHLORO-, HYDROCHLORIDE is used as a key intermediate in the synthesis of pharmaceuticals. Its reactivity and stability make it a valuable component in the development of new drugs and medications.
Used in Chemical Reactions:
P-ANISIDINE, 2-CHLORO-, HYDROCHLORIDE is used as a reactant in various chemical reactions due to its enhanced reactivity. The addition of the chlorine atom to the anisidine molecule allows for the formation of new compounds and the modification of existing ones, expanding the range of possible applications in the chemical industry.
Used in Industrial Processes:
P-ANISIDINE, 2-CHLORO-, HYDROCHLORIDE is used as a component in industrial processes due to its stability and solubility in the hydrochloride salt form. Its ease of handling and use makes it a preferred choice for various applications in the chemical and pharmaceutical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 5407-52-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,0 and 7 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 5407-52:
(6*5)+(5*4)+(4*0)+(3*7)+(2*5)+(1*2)=83
83 % 10 = 3
So 5407-52-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H8ClNO.ClH/c1-10-5-2-3-7(9)6(8)4-5;/h2-4H,9H2,1H3;1H
