5408-57-1 Usage
Uses
Used in Food Industry:
7-methyl-3-octanone is used as a flavoring agent for its pleasant and fruity odor, enhancing the taste and aroma of various food products.
Used in Cosmetic and Perfume Industry:
In the cosmetic and perfume industry, 7-methyl-3-octanone is utilized as a fragrance ingredient, contributing to the creation of enticing scents in products such as perfumes, lotions, and soaps.
Used in Pharmaceutical Industry:
7-methyl-3-octanone is employed in the pharmaceutical industry due to its potential therapeutic properties, offering a wide range of applications in the development of medicinal products.
Used in Chemical Industry:
As a solvent and chemical intermediate, 7-methyl-3-octanone plays a crucial role in the production of other compounds, facilitating various chemical reactions and processes.
Check Digit Verification of cas no
The CAS Registry Mumber 5408-57-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,0 and 8 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 5408-57:
(6*5)+(5*4)+(4*0)+(3*8)+(2*5)+(1*7)=91
91 % 10 = 1
So 5408-57-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H18O/c1-4-9(10)7-5-6-8(2)3/h8H,4-7H2,1-3H3
