54120-69-3 Usage
Description
p-Dioxane-2,6-dimethanol, also known as 4-methylene-1,3-dioxolan-2-methanol, is an organic compound with the chemical formula C5H10O3. It is a yellow oil at room temperature and is commonly used in the pharmaceutical industry for the synthesis of various drugs.
Uses
Used in Pharmaceutical Industry:
p-Dioxane-2,6-dimethanol is used as a key intermediate in the synthesis of antidiabetic agents that also possess anti-inflammatory or analgesic properties. Its unique chemical structure allows for the development of drugs that can effectively manage diabetes while also providing relief from inflammation and pain.
Used in Chemical Synthesis:
Due to its reactive functional groups, p-Dioxane-2,6-dimethanol can be utilized in various chemical reactions, leading to the formation of a wide range of compounds with diverse applications in different industries. Its versatility as a synthetic building block makes it a valuable asset in the field of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 54120-69-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,4,1,2 and 0 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 54120-69:
(7*5)+(6*4)+(5*1)+(4*2)+(3*0)+(2*6)+(1*9)=93
93 % 10 = 3
So 54120-69-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H12O4/c7-1-5-3-9-4-6(2-8)10-5/h5-8H,1-4H2
