541537-57-9 Usage
General Description
CHEMBRDG-BB 7251358 is a chemical compound used in the fields of chemistry and pharmaceuticals. It is classified as a benzamide derivative and is commonly used as a building block or intermediate in the synthesis of various organic compounds. This chemical has potential applications in drug discovery and medicinal chemistry due to its structural and functional properties. Its exact uses and specific properties are not widely documented, but it is an important chemical in the development of new compounds for various scientific and industrial purposes.
Check Digit Verification of cas no
The CAS Registry Mumber 541537-57-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,4,1,5,3 and 7 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 541537-57:
(8*5)+(7*4)+(6*1)+(5*5)+(4*3)+(3*7)+(2*5)+(1*7)=149
149 % 10 = 9
So 541537-57-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H15NO3/c11-8(5-6-9(12)13)10-7-3-1-2-4-7/h7H,1-6H2,(H,10,11)(H,12,13)
