5418-50-8 Usage
Uses
Used in Pharmaceutical Industry:
3-Pentanone, 2-(1,3-dioxolan-2-ylidene)is used as a solvent and in organic synthesis processes for the production of various pharmaceutical compounds. Its properties make it suitable for use in the synthesis of drugs and other medicinal products.
Used in Perfume Industry:
In the perfume industry, 3-Pentanone, 2-(1,3-dioxolan-2-ylidene)is used as a solvent and in the synthesis of various fragrance components. Its fruity odor and stability make it a valuable ingredient in creating different scents.
Used in Flavorings Industry:
3-Pentanone, 2-(1,3-dioxolan-2-ylidene)is also utilized in the flavorings industry, where it serves as a solvent and is involved in the synthesis of various flavor compounds. Its fruity aroma contributes to the development of unique tastes in food and beverage products.
Check Digit Verification of cas no
The CAS Registry Mumber 5418-50-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,1 and 8 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 5418-50:
(6*5)+(5*4)+(4*1)+(3*8)+(2*5)+(1*0)=88
88 % 10 = 8
So 5418-50-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H12O3/c1-3-7(9)6(2)8-10-4-5-11-8/h3-5H2,1-2H3
