5421-95-4 Usage
Uses
Used in Pharmaceutical Industry:
1-(3-Phenyl-1,2,4-oxadiazol-5-yl)urea is used as a pharmaceutical candidate for its anticonvulsant, anti-inflammatory, and anticancer properties. Its diverse biological activities make it a promising candidate for the development of new pharmaceuticals to treat various medical conditions.
Used in Chemical Synthesis:
1-(3-Phenyl-1,2,4-oxadiazol-5-yl)urea is used as a target for chemical synthesis and functionalization. Its unique structure and reactivity make it an interesting compound for the development of novel materials and compounds with specialized properties, potentially leading to advancements in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 5421-95-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,2 and 1 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 5421-95:
(6*5)+(5*4)+(4*2)+(3*1)+(2*9)+(1*5)=84
84 % 10 = 4
So 5421-95-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H8N4O2/c10-8(14)12-9-11-7(13-15-9)6-4-2-1-3-5-6/h1-5H,(H3,10,11,12,13,14)
