54210-33-2 Usage
Highly explosive
This substance is extremely sensitive to impact, friction, and heat, making it dangerous and requiring extreme caution during handling.
Starting material in synthesis
1-Methyl-5-nitropyrazole is primarily used as a starting material in the production of pharmaceuticals and agrochemicals.
Precursor for other organic compounds
1-Methyl-5-nitropyrazole serves as a chemical building block for the synthesis of various other organic compounds.
Unstable nature
1-Methyl-5-nitropyrazole is prone to decomposition and requires a controlled environment for storage and handling to prevent accidents.
Powerful oxidizing agent
This substance has strong oxidizing properties, which can lead to violent reactions with other chemicals.
Hazardous material
Due to its reactivity and instability, 1-Methyl-5-nitropyrazole is considered a hazardous material that must be managed properly to ensure safety.
Check Digit Verification of cas no
The CAS Registry Mumber 54210-33-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,4,2,1 and 0 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 54210-33:
(7*5)+(6*4)+(5*2)+(4*1)+(3*0)+(2*3)+(1*3)=82
82 % 10 = 2
So 54210-33-2 is a valid CAS Registry Number.
InChI:InChI=1/C4H5N3O2/c1-6-4(7(8)9)2-3-5-6/h2-3H,1H3
