5423-98-3 Usage
Uses
Used in Pharmaceutical Industry:
5-(BromoMethyl)-2-Methyl-4-pyriMidinaMine HydrobroMide is used as a synthetic building block for the development of new pharmaceutical compounds. Its ability to be incorporated into the structure of vitamin B1 analogs and thiaminephosphoric acid esters makes it a valuable asset in the creation of novel drugs with potential therapeutic applications.
Used in Chemical Synthesis:
In the field of chemical synthesis, 5-(BromoMethyl)-2-Methyl-4-pyriMidinaMine HydrobroMide serves as an essential intermediate for the production of various organic compounds. Its unique structure allows for the formation of new bonds and the creation of complex molecules with specific properties, making it a versatile tool in the synthesis of a wide range of chemicals.
Used in Research and Development:
5-(BromoMethyl)-2-Methyl-4-pyriMidinaMine HydrobroMide is also utilized in research and development laboratories for the exploration of new chemical reactions and the discovery of novel compounds. Its reactivity and structural diversity make it an attractive candidate for studying various chemical processes and understanding the underlying mechanisms involved.
Check Digit Verification of cas no
The CAS Registry Mumber 5423-98-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,2 and 3 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 5423-98:
(6*5)+(5*4)+(4*2)+(3*3)+(2*9)+(1*8)=93
93 % 10 = 3
So 5423-98-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H8BrN3/c1-4-9-3-5(2-7)6(8)10-4/h3H,2H2,1H3,(H2,8,9,10)
