54266-80-7 Usage
Chemical structure
The compound consists of an oxathiolane ring with a propyl group at the 5-position and an O-((methylamino)carbonyl)oxime group attached to the ring.
Stereochemistry
The compound exists in a Z configuration, which indicates the arrangement of atoms in the molecule.
Potential applications
Due to its unique structure, the compound may have potential applications in pharmaceuticals or organic synthesis.
Further research
Further studies and assessments would be needed to fully understand the properties and potential uses of 1,3-Oxathiolan-4-one, 5-propyl-, O-((methylamino)carbonyl)oxime, (Z)-.
Importance
The compound could be of interest for research and development in pharmaceuticals and organic synthesis due to its unique structure and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 54266-80-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,4,2,6 and 6 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 54266-80:
(7*5)+(6*4)+(5*2)+(4*6)+(3*6)+(2*8)+(1*0)=127
127 % 10 = 7
So 54266-80-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H14N2O3S/c1-3-4-6-7(14-5-12-6)10-13-8(11)9-2/h6H,3-5H2,1-2H3,(H,9,11)/b10-7-
