5427-44-1 Usage
Molecular structure
Urea derivative with a benzyl and quinolin-4-ylmethyl group
Potential applications
Medicinal chemistry and drug development
Unique structure
Contributes to its potential pharmacological activities
Hazards
May have certain hazards associated with its use
Precautionary measures
Necessary when handling and using this chemical
Research status
Further research is needed to fully understand its properties and potential applications
Check Digit Verification of cas no
The CAS Registry Mumber 5427-44-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,2 and 7 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 5427-44:
(6*5)+(5*4)+(4*2)+(3*7)+(2*4)+(1*4)=91
91 % 10 = 1
So 5427-44-1 is a valid CAS Registry Number.
InChI:InChI=1/C18H17N3O/c19-18(22)21(12-14-6-2-1-3-7-14)13-15-10-11-20-17-9-5-4-8-16(15)17/h1-11H,12-13H2,(H2,19,22)
