5429-62-9 Usage
General Description
Ethyl=(1H-benzimidazol-2-ylthio)acetate is a chemical compound with the molecular formula C12H13N3O2S. It is a thioester derivative of benzimidazole, which is commonly used in the synthesis of various pharmaceutical and organic compounds. Ethyl=(1H-benzimidazol-2-ylthio)acetate has a thioether functional group and an ethyl ester group, making it a versatile intermediate in organic synthesis. It has potential applications in the pharmaceutical industry, particularly in the development of drugs targeting various diseases and conditions. Additionally, the compound may also have uses in the agricultural and chemical industries for the synthesis of specialized products. Overall, Ethyl=(1H-benzimidazol-2-ylthio)acetate is a valuable and versatile chemical compound with potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 5429-62-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,2 and 9 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 5429-62:
(6*5)+(5*4)+(4*2)+(3*9)+(2*6)+(1*2)=99
99 % 10 = 9
So 5429-62-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H12N2O2S/c1-2-15-10(14)7-16-11-12-8-5-3-4-6-9(8)13-11/h3-6H,2,7H2,1H3,(H,12,13)