54329-48-5 Usage
Uses
Used in Pharmaceutical Industry:
2-Benzyl-1,2,3,4-tetrahydro-isoquinoline-3-carboxylic acid is used as a pharmaceutical candidate for its potential therapeutic effects. Its pharmacological properties make it a promising agent for the development of new drugs and treatments.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 2-Benzyl-1,2,3,4-tetrahydro-isoquinoline-3-carboxylic acid is used as a subject of study to explore its potential applications and interactions with biological systems. Its unique structure and properties provide valuable insights into the development of new compounds and therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 54329-48-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,4,3,2 and 9 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 54329-48:
(7*5)+(6*4)+(5*3)+(4*2)+(3*9)+(2*4)+(1*8)=125
125 % 10 = 5
So 54329-48-5 is a valid CAS Registry Number.
InChI:InChI=1/C17H17NO2/c19-17(20)16-10-14-8-4-5-9-15(14)12-18(16)11-13-6-2-1-3-7-13/h1-9,16H,10-12H2,(H,19,20)
