5434-18-4 Usage
Molecular structure
1-benzo[1,3]dioxol-5-ylbut-3-enyl undec-10-enoate has a complex molecular structure consisting of a benzo[1,3]dioxole ring, but-3-enyl, and undec-10-enoate functional groups.
Aromatic and aliphatic properties
The compound possesses both aromatic and aliphatic properties due to the presence of the benzo[1,3]dioxole ring and the but-3-enyl and undec-10-enoate functional groups.
Potential applications
This chemical may have potential applications in various fields, such as pharmaceutical, cosmetic, or industrial, although further research and analysis are required to determine its exact properties, uses, and safety considerations.
Derivation
1-benzo[1,3]dioxol-5-ylbut-3-enyl undec-10-enoate is derived from the combination of benzo[1,3]dioxole, but-3-enyl, and undec-10-enoate.
Further research needed
To fully understand the properties, potential uses, and safety considerations of 1-benzo[1,3]dioxol-5-ylbut-3-enyl undec-10-enoate, additional research and analysis are necessary.
Check Digit Verification of cas no
The CAS Registry Mumber 5434-18-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,3 and 4 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 5434-18:
(6*5)+(5*4)+(4*3)+(3*4)+(2*1)+(1*8)=84
84 % 10 = 4
So 5434-18-4 is a valid CAS Registry Number.
InChI:InChI=1/C22H30O4/c1-3-5-6-7-8-9-10-11-13-22(23)26-19(12-4-2)18-14-15-20-21(16-18)25-17-24-20/h3-4,14-16,19H,1-2,5-13,17H2