5435-32-5 Usage
Description
1-(4-bromophenyl)-2H-pyridazine-3,6-dione is a chemical compound characterized by the molecular formula C10H5BrN2O2. It is a pyridazine derivative featuring a bromine-substituted phenyl group, which contributes to its unique chemical properties and potential applications.
Uses
Used in Pharmaceutical Industry:
1-(4-bromophenyl)-2H-pyridazine-3,6-dione is utilized as a compound in the pharmaceutical industry, specifically for drug discovery and development. Its unique structure allows it to serve as a potential candidate for the creation of new drugs targeting various medical conditions.
Used in Organic Synthesis:
In the field of organic synthesis, 1-(4-bromophenyl)-2H-pyridazine-3,6-dione is employed as an intermediate. It can be used to produce other chemical compounds with specific properties or functionalities, contributing to the development of novel materials and substances with potential applications in various industries.
Safety and Handling:
It is crucial to handle and store 1-(4-bromophenyl)-2H-pyridazine-3,6-dione according to standard safety protocols. This is to ensure that any health or environmental risks associated with the compound are minimized, maintaining a safe working environment and reducing the potential for harm to the ecosystem.
Check Digit Verification of cas no
The CAS Registry Mumber 5435-32-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,3 and 5 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 5435-32:
(6*5)+(5*4)+(4*3)+(3*5)+(2*3)+(1*2)=85
85 % 10 = 5
So 5435-32-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H7BrN2O2/c11-7-1-3-8(4-2-7)13-10(15)6-5-9(14)12-13/h1-6H,(H,12,14)
5435-32-5Relevant articles and documents
Expedient synthesis of new cinnoline diones by Ru-catalyzed regioselective unexpected deoxygenation-oxidative annulation of propargyl alcohols with phthalazinones and pyridazinones
Rajkumar, Subramani,Antony Savarimuthu,Senthil Kumaran, Rajendran,Nagaraja,Gandhi, Thirumanavelan
supporting information, p. 2509 - 2512 (2016/02/12)
Ruthenium-catalyzed simple, cascade and one-pot synthesis of cinnoline-fused diones has been carried out by the C-H activation of phthalazinones/pyridazinones accomplished by the unusual deoxygenation of propargyl alcohols. The bond selectivity is accredited to the traceless directing nature of the hydroxyl group of propargyl alcohol. A sequential C-H activation, insertion and deoxy-oxidative annulation has been proposed based on the preliminary mechanistic study.