5435-41-6 Usage
Uses
Used in Pharmaceutical Industry:
2-(2,7-dimethyl-1H-indol-3-yl)acetic acid is used as a research chemical for the development of novel therapeutic agents, primarily due to its structural similarity to serotonin and its potential psychoactive effects. It is being investigated for its potential in the treatment of mood disorders and psychiatric illnesses, as it may interact with the serotonin system in the brain.
Used in Neuroscience Research:
In the field of neuroscience, 2-(2,7-dimethyl-1H-indol-3-yl)acetic acid serves as a valuable research tool for studying the mechanisms of action and potential therapeutic effects of tryptamine derivatives. Its structural resemblance to serotonin allows researchers to explore its interactions with neurotransmitter systems and evaluate its potential as a modulator of mood and behavior.
Used in Medicinal Chemistry:
2-(2,7-dimethyl-1H-indol-3-yl)acetic acid is utilized in medicinal chemistry for the synthesis of new compounds with potential therapeutic applications. Its unique structure and properties make it a promising candidate for the development of drugs targeting mood disorders and psychiatric illnesses, as well as other conditions that may benefit from modulation of the serotonin system.
Check Digit Verification of cas no
The CAS Registry Mumber 5435-41-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,3 and 5 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 5435-41:
(6*5)+(5*4)+(4*3)+(3*5)+(2*4)+(1*1)=86
86 % 10 = 6
So 5435-41-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H13NO2/c1-7-4-3-5-9-10(6-11(14)15)8(2)13-12(7)9/h3-5,13H,6H2,1-2H3,(H,14,15)
5435-41-6Relevant academic research and scientific papers
Compounds exhibiting thrombopoietin-like activities
-
, (2008/06/13)
The compounds of the invention are compounds represented by the following general formula (1): wherein E represents one selected from the group consisting of a methylidyne group and a nitrilo group, R1 represents one selected from the group consisting of optionally substituted aryl groups and optionally substituted heteroaryl groups, R2 represents one selected from the group consisting of a hydrogen atom and alkyl groups, W1 represents an amino acid residue, A represents one selected from the group consisting of a carbonyl group and a sulfonyl group, X1 represents one selected from the group consisting of optionally substituted alkylene groups and optionally substituted alkenylene groups, and p represents 0 or 1; and their pharmacologically acceptable salts, which exhibit thrombopoietin-like activity.
