5436-01-1 Usage
Uses
Used in Pharmaceutical Industry:
3-HYDROXY-1-METHYLPYRIDAZIN-6(1H)-ONE is used as a potential lead compound for drug development due to its unique structure and potential biological and pharmacological properties. It is particularly valuable in medicinal chemistry for the creation of new therapeutic agents.
Used in Agrochemical Industry:
In the agrochemical sector, 3-HYDROXY-1-METHYLPYRIDAZIN-6(1H)-ONE is used as a building block in the synthesis of various agrochemicals, potentially contributing to the development of new pesticides or other agricultural chemicals.
Used in Materials Science:
3-HYDROXY-1-METHYLPYRIDAZIN-6(1H)-ONE is utilized in materials science for its potential to contribute to the development of new materials with unique properties, thanks to its versatile chemical structure.
The specific biological and pharmacological activities of 3-HYDROXY-1-METHYLPYRIDAZIN-6(1H)-ONE are still under investigation, but its unique structure makes it a promising target for further research and development across these industries.
Check Digit Verification of cas no
The CAS Registry Mumber 5436-01-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,3 and 6 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 5436-01:
(6*5)+(5*4)+(4*3)+(3*6)+(2*0)+(1*1)=81
81 % 10 = 1
So 5436-01-1 is a valid CAS Registry Number.
InChI:InChI=1/C5H6N2O2/c1-7-5(9)3-2-4(8)6-7/h2-3H,1H3,(H,6,8)
5436-01-1Relevant academic research and scientific papers
CYCLOPROPANE DERIVATIVES
-
Page/Page column 32, (2012/07/13)
A cyclopropane derivative represented by the following formula (I) or a pharmaceutically acceptable salt thereof has orexin receptor inhibitory action, and thus, is extremely useful as an agent for preventing or treating sleep disorder or dyssomnia caused by orexin, including insomnia as a typical example: wherein A1, A2 and A3 each independently represent an aryl group, a heterocyclyl group or the like, R1, R2 and R3 each independently represent a hydrogen atom, a C1-6 alkyl group or the like, X represents an oxygen atom or the like, and L represents a bond or the like.
Synthesis of the potassium channel opener (3S,4R)-3,4-dihydro-4-(2,3- dihydro-2-methyl-3-oxo-pyridazin-6-yl)oxy-3-hydroxy-6-(3-hydroxyphenyl) sulphonyl-2,2,3-trimethyl-2H-benzo[b]pyran
Magano, Javier,Acciacca, Allison,Beylin, Vladimir,Spence, Julie,Dunn, Peter,Hughes, Mike
, p. 3569 - 3578 (2008/03/14)
The preparation of the potassium channel opener (3S,4R)-3,4-dihydro-4-(2,3- dihydro-2-methyl-3-oxo-pyridazin-6-yl)oxy-3-hydroxy-6-(3-hydroxyphenyl) sulphonyl-2,2,3-trimethyl-2H-benzo[b]pyran (1) as a single enantiomer is reported. Considerable improvement
