5438-51-7 Usage
Uses
Used in Organic Synthesis:
[4-(cyanomethyl)-2-methoxy-phenyl] acetate is used as a reagent in organic synthesis for the preparation of various complex organic molecules. Its unique structure allows for versatile chemical reactions, making it a valuable component in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, [4-(cyanomethyl)-2-methoxy-phenyl] acetate is used as a building block for the development of new drugs. Its chemical properties enable it to be incorporated into the molecular structures of potential therapeutic agents, contributing to their biological activity and pharmacological properties.
Used in Materials Industry:
[4-(cyanomethyl)-2-methoxy-phenyl] acetate is also utilized in the materials industry for the development of advanced materials with specific properties. Its incorporation into polymers and other materials can enhance their performance, making them suitable for various applications, such as coatings, adhesives, and composites.
Check Digit Verification of cas no
The CAS Registry Mumber 5438-51-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,3 and 8 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 5438-51:
(6*5)+(5*4)+(4*3)+(3*8)+(2*5)+(1*1)=97
97 % 10 = 7
So 5438-51-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H11NO3/c1-8(13)15-10-4-3-9(5-6-12)7-11(10)14-2/h3-4,7H,5H2,1-2H3
