544-51-4 Usage
Uses
Used in Pharmaceutical Industry:
(3E,5Z)-3,5,7,8-Tridecatetraene-10,12-diynoic acid is used as a pharmaceutical compound for its potential therapeutic applications. The specific reasons for its use in this industry include its unique chemical structure, which may allow for targeted drug delivery and interaction with biological systems.
Used in Chemical Synthesis:
In the chemical synthesis industry, (3E,5Z)-3,5,7,8-Tridecatetraene-10,12-diynoic acid can be used as a building block or intermediate for the creation of more complex molecules. Its allenic system and triple bonds make it a versatile starting material for the synthesis of various compounds with specific properties.
Used in Material Science:
(3E,5Z)-3,5,7,8-Tridecatetraene-10,12-diynoic acid may also find applications in material science, particularly in the development of novel materials with unique properties. Its polyunsaturated nature and the presence of multiple double and triple bonds could contribute to the creation of materials with enhanced strength, flexibility, or other desirable characteristics.
Used in Research and Development:
Due to its unique structure, (3E,5Z)-3,5,7,8-Tridecatetraene-10,12-diynoic acid can be used in research and development for studying the effects of different functional groups and bond configurations on the properties of molecules. This can lead to a better understanding of molecular interactions and the development of new compounds with specific applications.
Check Digit Verification of cas no
The CAS Registry Mumber 544-51-4 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 5,4 and 4 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 544-51:
(5*5)+(4*4)+(3*4)+(2*5)+(1*1)=64
64 % 10 = 4
So 544-51-4 is a valid CAS Registry Number.
InChI:InChI=1/C13H10O2/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15/h1,5,7-11H,12H2,(H,14,15)/b9-8-,11-10+
