5446-24-2 Usage
Uses
Used in Pharmaceutical Industry:
(1-acetyl-6-chloro-2-methyl-indol-3-yl) acetate is used as a pharmaceutical intermediate for the synthesis of various drugs due to its potential biological activities, such as anti-inflammatory and anti-cancer properties. Its unique chemical structure allows it to be a promising candidate for the development of new therapeutic agents.
Used in Agrochemical Industry:
(1-acetyl-6-chloro-2-methyl-indol-3-yl) acetate is used as a chemical intermediate in the agrochemical industry for the synthesis of various agrochemical products. Its potential applications in this industry may include the development of new pesticides, herbicides, or other agricultural chemicals that can improve crop yield and protect plants from pests and diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 5446-24-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,4 and 6 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 5446-24:
(6*5)+(5*4)+(4*4)+(3*6)+(2*2)+(1*4)=92
92 % 10 = 2
So 5446-24-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H12ClNO3/c1-7-13(18-9(3)17)11-5-4-10(14)6-12(11)15(7)8(2)16/h4-6H,1-3H3
5446-24-2Relevant academic research and scientific papers
The Ullmann coupling between 2-chlorobenzoic acids and amino acids; a valuable reaction for preparing 2-substituted 1-acetyl-1H-indol-3-yl acetates
Dominguez, Juan Carlos Rodriguez,Gang, Xiao,Kirsch, Gilbert
scheme or table, p. 2345 - 2348 (2010/01/15)
2-Substituted 3-acetoxy-1-acetyl-1H-indoles were prepared by condensing 2-chlorobenzoic acids with amino acids under Ullmann conditions in good yields, and further cyclodecarboxylation using the Roessing method in moderate to good yields. Georg Thieme Ver
