54499-06-8 Usage
Chemical structure
1,3,4,6,7-Pentaazacycl[3.3.3]azine is a heterocyclic compound with a six-membered ring containing five nitrogen atoms.
Symmetry
The molecule is highly symmetrical, which contributes to its unique properties.
Coordination chemistry
Pentaazacyclophane can be used as a ligand in coordination chemistry, allowing it to form complexes with metal ions.
Supramolecular assemblies
The compound can be used as a building block for supramolecular assemblies, which are structures formed by the non-covalent interaction of multiple molecules.
Precursor for synthesis
Pentaazacyclophane can be used as a precursor for the synthesis of other nitrogen-rich compounds, expanding its potential applications.
Rigid structure
The compound has a rigid structure due to its highly conjugated system, which can influence its stability and reactivity.
Potential applications
Due to its unique properties, pentaazacyclophane has potential applications in the development of novel functional materials and molecular devices.
Versatility
The compound is versatile, with potential applications in a range of fields, including chemistry and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 54499-06-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,4,4,9 and 9 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 54499-06:
(7*5)+(6*4)+(5*4)+(4*9)+(3*9)+(2*0)+(1*6)=148
148 % 10 = 8
So 54499-06-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H4N6/c1-2-8-6-11-4-12-7-10-3-9-5(1)13(6)7/h1-4H
