54503-13-8 Usage
Uses
Used in Pharmaceutical Industry:
(S)-3-(3-Hydroxy-4-Methoxyphenyl)-Beta-Alanine is used as a building block for the synthesis of peptides and proteins for potential therapeutic applications. Its unique structure may contribute to the development of novel drugs with specific biological activities.
Used in Research and Development:
(S)-3-(3-Hydroxy-4-Methoxyphenyl)-Beta-Alanine is used as a research compound to study its potential biological roles and interactions within biological systems. This may lead to a better understanding of its potential applications in medicine and other fields.
Used in Chemical Synthesis:
(S)-3-(3-Hydroxy-4-Methoxyphenyl)-Beta-Alanine is used as a starting material or intermediate in the synthesis of more complex organic compounds, which may have various applications in different industries, such as pharmaceuticals, agrochemicals, or materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 54503-13-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,4,5,0 and 3 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 54503-13:
(7*5)+(6*4)+(5*5)+(4*0)+(3*3)+(2*1)+(1*3)=98
98 % 10 = 8
So 54503-13-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H13NO4/c1-15-9-3-2-6(4-8(9)12)7(11)5-10(13)14/h2-4,7,12H,5,11H2,1H3,(H,13,14)/t7-/m0/s1
