5454-01-3 Usage
Uses
Used in Pharmaceutical Research:
(6-hydroxy-5,6-dihydro-4H-pyridazin-1-yl)-phenyl-methanone is used as a research compound for drug development and medicinal chemistry. Its unique structure and potential pharmacological properties make it a valuable candidate for the creation of new drugs and therapeutic agents.
Used in Chemical Product Synthesis:
In the chemical industry, (6-hydroxy-5,6-dihydro-4H-pyridazin-1-yl)-phenyl-methanone may be utilized as a key intermediate or building block in the synthesis of various pharmaceuticals and other chemical products. Its versatility in chemical reactions and potential for modification contribute to its industrial applications.
Further Research:
(6-hydroxy-5,6-dihydro-4H-pyridazin-1-yl)-phenyl-methanone is used as a subject of study for further research to explore its properties, potential uses, and to understand its biological activities. This research could lead to the discovery of new applications in various fields, including medicine, pharmaceuticals, and the chemical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 5454-01-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,5 and 4 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 5454-01:
(6*5)+(5*4)+(4*5)+(3*4)+(2*0)+(1*1)=83
83 % 10 = 3
So 5454-01-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H12N2O2/c14-10-7-4-8-12-13(10)11(15)9-5-2-1-3-6-9/h1-3,5-6,8,10,14H,4,7H2