5455-81-2 Usage
Uses
Used in Organic Synthesis:
5,6-Dibromohexahydro-4,7-methanoisobenzofuran-1,3-dione is used as a valuable tool in organic synthesis for its interesting structure and reactivity. Its unique molecular composition allows it to be a potential candidate for the development of new chemical entities and reactions.
Used in Chemical Research:
In the field of chemical research, 5,6-Dibromohexahydro-4,7-methanoisobenzofuran-1,3-dione is employed to explore its properties and potential applications. Its complex structure offers opportunities for studying various chemical reactions and mechanisms, contributing to the advancement of scientific knowledge.
Used in Laboratory Settings:
5,6-Dibromohexahydro-4,7-methanoisobenzofuran-1,3-dione is utilized in laboratory settings for conducting experiments and testing its reactivity with other compounds. Its presence in controlled environments allows researchers to safely investigate its potential uses and understand its behavior under various conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 5455-81-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,5 and 5 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 5455-81:
(6*5)+(5*4)+(4*5)+(3*5)+(2*8)+(1*1)=102
102 % 10 = 2
So 5455-81-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H8Br2O3/c10-6-2-1-3(7(6)11)5-4(2)8(12)14-9(5)13/h2-7H,1H2
