54553-91-2 Usage
General Description
Pyromellitic acid di(2-phenyl-2-imidazoline) salt is a chemical compound that is formed by the reaction of pyromellitic acid and 2-phenyl-2-imidazoline. It is used as a corrosion inhibitor in various industrial applications, particularly in the oil and gas industry. Pyromellitic acid di(2-phenyl-2-imidazoline) salt is effective at preventing the degradation of metal surfaces caused by corrosive substances, such as acids and salt water. Additionally, it is utilized in the formulation of metalworking fluids and lubricants to enhance the performance and longevity of equipment. Pyromellitic acid di(2-phenyl-2-imidazoline) salt is a versatile and valuable chemical that plays a crucial role in protecting metal components from corrosion.
Check Digit Verification of cas no
The CAS Registry Mumber 54553-91-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,4,5,5 and 3 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 54553-91:
(7*5)+(6*4)+(5*5)+(4*5)+(3*3)+(2*9)+(1*1)=132
132 % 10 = 2
So 54553-91-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H6O8.2C9H10N2/c11-7(12)3-1-4(8(13)14)6(10(17)18)2-5(3)9(15)16;2*1-2-4-8(5-3-1)9-10-6-7-11-9/h1-2H,(H,11,12)(H,13,14)(H,15,16)(H,17,18);2*1-5H,6-7H2,(H,10,11)