54561-77-2 Usage
Type of compound
Synthetic chemical compound
Usage
Reagent in organic chemistry and pharmaceutical research
Classification
Piperidine derivative
Structural feature
Contains a six-membered heterocyclic ring with a nitrogen atom
Potential applications
Synthesis of various pharmaceuticals and biological compounds
Reactivity
Unique structure and reactivity
Biological activities and pharmacological properties
May exhibit certain properties, but further research is necessary
Research status
Further research needed to fully understand its potential uses
Check Digit Verification of cas no
The CAS Registry Mumber 54561-77-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,4,5,6 and 1 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 54561-77:
(7*5)+(6*4)+(5*5)+(4*6)+(3*1)+(2*7)+(1*7)=132
132 % 10 = 2
So 54561-77-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H22N2O2/c16-12(14-7-3-1-4-8-14)11-13(17)15-9-5-2-6-10-15/h1-11H2
