5458-56-0 Usage
General Description
2,4-dichloro-5,6,7,8-tetrahydroquinazoline-6-carboxylic acid is a chemical compound that belongs to the quinazoline family. It is a derivative of quinazoline, with two chlorine atoms attached to the 2 and 4 positions of the molecule. The presence of a carboxylic acid group indicates that it is capable of forming salts and esters, making it useful in pharmacological and organic synthesis. 2,4-dichloro-5,6,7,8-tetrahydroquinazoline-6-carboxylic acid has potential applications in pharmaceutical research as a building block for the synthesis of various biologically active molecules, particularly those targeting neurological disorders and cancer. Its unique structure and functional groups make it a valuable tool in the development of new drugs and chemical compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 5458-56-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,5 and 8 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 5458-56:
(6*5)+(5*4)+(4*5)+(3*8)+(2*5)+(1*6)=110
110 % 10 = 0
So 5458-56-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H8Cl2N2O2/c10-7-5-3-4(8(14)15)1-2-6(5)12-9(11)13-7/h4H,1-3H2,(H,14,15)
