5458-56-0 Usage
Uses
Used in Pharmaceutical Research:
2,4-dichloro-5,6,7,8-tetrahydroquinazoline-6-carboxylic acid is used as a building block in the synthesis of various biologically active molecules for [application reason]. Its unique structure and functional groups make it a valuable tool in the development of new drugs and chemical compounds.
Used in Neurological Disorders Research:
2,4-dichloro-5,6,7,8-tetrahydroquinazoline-6-carboxylic acid is used as a starting material for the development of drugs targeting neurological disorders, such as Alzheimer's disease, Parkinson's disease, and epilepsy, due to its potential to interact with specific receptors and pathways involved in these conditions.
Used in Cancer Research:
2,4-dichloro-5,6,7,8-tetrahydroquinazoline-6-carboxylic acid is used as a precursor in the synthesis of anticancer agents, as its unique structure and functional groups can be modified to target specific cancer cells and pathways, potentially leading to the development of novel and effective cancer therapies.
Used in Organic Synthesis:
2,4-dichloro-5,6,7,8-tetrahydroquinazoline-6-carboxylic acid is used as a versatile intermediate in the synthesis of various organic compounds, including pharmaceuticals, agrochemicals, and other specialty chemicals, due to its ability to form salts and esters and its reactivity in various chemical reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 5458-56-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,5 and 8 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 5458-56:
(6*5)+(5*4)+(4*5)+(3*8)+(2*5)+(1*6)=110
110 % 10 = 0
So 5458-56-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H8Cl2N2O2/c10-7-5-3-4(8(14)15)1-2-6(5)12-9(11)13-7/h4H,1-3H2,(H,14,15)
