5466-71-7 Usage
Uses
Used in Pharmaceutical Industry:
2-(5-amino-9-phenyl-2,4,8,9-tetrazabicyclo[4.3.0]nona-1,3,5,7-tetraen-7-yl)acetonitrile is used as a pharmaceutical compound for its potential biological activity. Its unique molecular structure, including the tetrazole ring, amino group, and phenyl group, may contribute to its efficacy in treating various medical conditions.
Used in Medicinal Chemistry:
2-(5-amino-9-phenyl-2,4,8,9-tetrazabicyclo[4.3.0]nona-1,3,5,7-tetraen-7-yl)acetonitrile is used as a building block in medicinal chemistry for the development of new drugs. Its structural features, such as the bicyclic ring system and acetonitrile functional group, can be utilized to design and synthesize novel pharmaceutical agents with improved therapeutic properties.
Used in Organic Synthesis:
2-(5-amino-9-phenyl-2,4,8,9-tetrazabicyclo[4.3.0]nona-1,3,5,7-tetraen-7-yl)acetonitrile is used as a versatile building block in organic synthesis for the creation of new chemical compounds. Its unique molecular structure, including the bicyclic ring system and acetonitrile functional group, allows for the synthesis of a wide range of organic compounds with diverse applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 5466-71-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,6 and 6 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 5466-71:
(6*5)+(5*4)+(4*6)+(3*6)+(2*7)+(1*1)=107
107 % 10 = 7
So 5466-71-7 is a valid CAS Registry Number.
InChI:InChI=1/C13H10N6/c14-7-6-10-11-12(15)16-8-17-13(11)19(18-10)9-4-2-1-3-5-9/h1-5,8H,6H2,(H2,15,16,17)
