54705-92-9 Usage
Description
[5-chloro-2-(1H-imidazol-1-yl)phenyl]amine is a phenylamine derivative that features a chloro and imidazole group. This chemical compound is widely recognized in medicinal chemistry for its role in the development of pharmaceutical drugs, particularly within the realms of antifungal and antimicrobial agents. Its unique structure and properties render it a valuable building block for the synthesis of organic compounds and a starting material for the preparation of various heterocyclic compounds, making it a versatile component in both drug development and chemical synthesis.
Uses
Used in Pharmaceutical Industry:
[5-chloro-2-(1H-imidazol-1-yl)phenyl]amine is utilized as an active pharmaceutical ingredient for the development of antifungal and antimicrobial agents. Its chemical structure allows it to effectively target and combat a range of fungal and microbial pathogens, making it a crucial component in the creation of new treatments for various infections.
Used in Organic Synthesis:
In the field of organic synthesis, [5-chloro-2-(1H-imidazol-1-yl)phenyl]amine serves as a key building block for the synthesis of a variety of organic compounds. Its presence in these compounds can enhance their properties and contribute to the development of new chemical entities with potential applications in various industries.
Used in Heterocyclic Compound Preparation:
[5-chloro-2-(1H-imidazol-1-yl)phenyl]amine is also used as a starting material for the preparation of various heterocyclic compounds. Its unique structure enables the formation of complex and diverse heterocyclic systems, which are important in the fields of medicinal chemistry, materials science, and pharmaceuticals for their wide range of biological activities and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 54705-92-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,4,7,0 and 5 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 54705-92:
(7*5)+(6*4)+(5*7)+(4*0)+(3*5)+(2*9)+(1*2)=129
129 % 10 = 9
So 54705-92-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H8ClN3/c10-7-1-2-9(8(11)5-7)13-4-3-12-6-13/h1-6H,11H2
54705-92-9Relevant articles and documents
Part 3: Synthesis and biological evaluation of some analogs of the antitumor agents, 2-{4-[(7-chloro-2-quinoxalinyl)oxy]phenoxy}propionic acid, and 2-{4-[(7-bromo-2-quinolinyl)oxy]phenoxy}propionic acid
Hazeldine, Stuart T.,Polin, Lisa,Kushner, Juiwanna,White, Kathryn,Corbett, Thomas H.,Biehl, Jason,Horwitz, Jerome P.
, p. 1069 - 1081 (2007/10/03)
2-{4-[(7-Chloro-2-quinoxalinyl)oxy]phenoxy}propionic acid (X469) and 2-{4-[(7-bromo-2-quinolinyl)oxy]phenoxy}propionic Acid (SH80) are among the most highly and broadly active antitumor agents to have been developed in our laboratories. However, the mecha
