54831-91-3 Usage
Chemical composition
The compound consists of a platinum(II) ion coordinated with two ligands, 1,10-phenanthroline and ethylenediamine.
Coordination chemistry
1,10-phenanthroline-platinum(II)-ethylenediamine is frequently utilized in coordination chemistry due to its versatile reactivity and potential applications.
Medicinal chemistry
1,10-phenanthroline-platinum(II)-ethylenediamine has potential applications in medicinal chemistry, possibly due to its ability to form stable bonds with biological molecules.
Chelating ability
The 1,10-phenanthroline ligand is known for its strong chelating ability, which allows it to form stable bonds with metal ions.
Additional coordination sites
The ethylenediamine ligand provides additional coordination sites, allowing the complex to form stable bonds with a wide range of molecules and substrates.
Research fields
The compound is a valuable tool in various research fields, including chemistry, biology, and materials science.
Industrial applications
1,10-phenanthroline-platinum(II)-ethylenediamine has potential applications in various industries, such as pharmaceuticals, chemical manufacturing, and materials development.
Check Digit Verification of cas no
The CAS Registry Mumber 54831-91-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,4,8,3 and 1 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 54831-91:
(7*5)+(6*4)+(5*8)+(4*3)+(3*1)+(2*9)+(1*1)=133
133 % 10 = 3
So 54831-91-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H8N2.C2H8N2.Pt/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;3-1-2-4;/h1-8H;1-4H2;/q;;+2
