548767-83-5 Usage
General Description
4-Bromo-2-hydroxypyrimidine is a chemical compound with the molecular formula C4H3BrN2O. It belongs to the group of the pyrimidines and derivatives, which are compounds containing a pyrimidine ring, which is a six-member aromatic heterocycle, composed of two nitrogen atoms and four carbon atoms, and has one hydroxyl group substituted in the position 2 and a bromine atom in the position 4. This chemical is used primarily for scientific research and is typically synthesized in a laboratory setting. The compound appears as a light yellow to yellowish-brown crystalline powder. Its stability, reactivity and other properties can depend on factors such as temperature, pressure, and concentration.
Check Digit Verification of cas no
The CAS Registry Mumber 548767-83-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,4,8,7,6 and 7 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 548767-83:
(8*5)+(7*4)+(6*8)+(5*7)+(4*6)+(3*7)+(2*8)+(1*3)=215
215 % 10 = 5
So 548767-83-5 is a valid CAS Registry Number.
InChI:InChI=1/C4H3BrN2O/c5-3-1-2-6-4(8)7-3/h1-2H,(H,6,7,8)
