548767-83-5 Usage
Uses
Used in Scientific Research:
4-Bromo-2-hydroxypyrimidine is used as a research chemical for the development and study of various chemical reactions and processes. Its unique structure and properties make it a valuable compound for understanding the behavior of pyrimidines and their derivatives in different chemical environments.
Used in Pharmaceutical Industry:
4-Bromo-2-hydroxypyrimidine is used as an intermediate in the synthesis of pharmaceutical compounds. Its specific functional groups and structural features can be utilized in the development of new drugs with potential therapeutic applications.
Used in Chemical Synthesis:
4-Bromo-2-hydroxypyrimidine is used as a building block in the synthesis of various organic compounds. Its reactivity and the presence of the bromine atom make it a versatile starting material for the preparation of a wide range of chemical products.
Used in Material Science:
4-Bromo-2-hydroxypyrimidine can be used in the development of new materials with specific properties, such as optoelectronic materials, due to its aromatic heterocycle structure and the presence of the bromine atom, which can influence the electronic properties of the resulting materials.
Check Digit Verification of cas no
The CAS Registry Mumber 548767-83-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,4,8,7,6 and 7 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 548767-83:
(8*5)+(7*4)+(6*8)+(5*7)+(4*6)+(3*7)+(2*8)+(1*3)=215
215 % 10 = 5
So 548767-83-5 is a valid CAS Registry Number.
InChI:InChI=1/C4H3BrN2O/c5-3-1-2-6-4(8)7-3/h1-2H,(H,6,7,8)
