5489-15-6 Usage
General Description
O-Methylisocorydine iodomethylate is a chemical compound that is a derivative of the alkaloid isocorydine. It is a potent anti-inflammatory and analgesic agent, and has been investigated for its potential as a treatment for various inflammatory and pain-related conditions. O-Methylisocorydine iodomethylate has also shown antimicrobial and antifungal activity, making it a promising candidate for the development of novel antimicrobial agents. Additionally, it has been studied for its potential as an anti-cancer agent, showing promising results in inhibiting the growth of certain cancer cell lines. Overall, O-Methylisocorydine iodomethylate holds potential for various therapeutic applications and further research is ongoing to explore its pharmacological properties.
Check Digit Verification of cas no
The CAS Registry Mumber 5489-15-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,8 and 9 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 5489-15:
(6*5)+(5*4)+(4*8)+(3*9)+(2*1)+(1*5)=116
116 % 10 = 6
So 5489-15-6 is a valid CAS Registry Number.
InChI:InChI=1/C19H14N2OS/c22-18-16-10-3-4-11-17(16)20-19(21-18)23-12-14-8-5-7-13-6-1-2-9-15(13)14/h1-11H,12H2,(H,20,21,22)