5493-95-8 Usage
Uses
Used in Pharmaceutical Industry:
6-PHENYL-MORPHOLIN-3-ONE is used as a building block for the synthesis of complex organic molecules, contributing to the development of innovative pharmaceutical compounds.
Used as an Intermediate in Drug Production:
In the pharmaceutical industry, 6-PHENYL-MORPHOLIN-3-ONE serves as a valuable intermediate in the production of certain pharmaceutical drugs, playing a crucial role in the manufacturing process.
Used as a Reagent in Organic Synthesis:
6-PHENYL-MORPHOLIN-3-ONE is utilized as a reagent in organic synthesis, aiding in various chemical reactions and processes to produce desired organic compounds.
Potential Biological and Pharmacological Activities:
6-PHENYL-MORPHOLIN-3-ONE may have potential biological and pharmacological activities that warrant further study, indicating its possible use in the development of new therapeutic agents or treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 5493-95-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,9 and 3 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 5493-95:
(6*5)+(5*4)+(4*9)+(3*3)+(2*9)+(1*5)=118
118 % 10 = 8
So 5493-95-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H11NO2/c12-10-7-13-9(6-11-10)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,11,12)
