54934-71-3 Usage
Chemical structure
A complex hydrocarbon compound consisting of multiple cyclopentyl and pentene groups.
Molecular weight
Likely high due to the presence of multiple carbon and hydrogen atoms.
Physical state
Likely a liquid or solid at room temperature.
Applications
Potential uses in organic synthesis, industrial processes, or pharmaceutical research due to its unique structure and potential reactivity.
Synthesis
Advanced laboratory techniques and equipment are likely needed to synthesize 1,5-Dicyclopentyl-3-(2-cyclopentylethyl)-2-pentene.
Analysis
Advanced laboratory techniques and equipment are likely needed to analyze 1,5-Dicyclopentyl-3-(2-cyclopentylethyl)-2-pentene.
Reactivity
The compound may have unique reactivity due to its complex structure.
Stability
The stability of the compound may depend on factors such as temperature, pressure, and the presence of other chemicals.
Solubility
The solubility of the compound may depend on factors such as the solvent used and the compound's molecular structure.
Safety
The safety of the compound may depend on factors such as its reactivity, stability, and potential toxicity. It is important to follow proper safety protocols when handling 1,5-Dicyclopentyl-3-(2-cyclopentylethyl)-2-pentene.
Check Digit Verification of cas no
The CAS Registry Mumber 54934-71-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,4,9,3 and 4 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 54934-71:
(7*5)+(6*4)+(5*9)+(4*3)+(3*4)+(2*7)+(1*1)=143
143 % 10 = 3
So 54934-71-3 is a valid CAS Registry Number.
InChI:InChI=1/C22H38/c1-2-8-19(7-1)13-16-22(17-14-20-9-3-4-10-20)18-15-21-11-5-6-12-21/h16,19-21H,1-15,17-18H2
