549478-39-9 Usage
General Description
CHEMBRDG-BB 5695179 is a chemical compound with the molecular formula C16H9BrN2O2. It belongs to the class of organic compounds known as benzimidazoles. It is a synthetic compound that has the potential for various pharmaceutical applications, including as a potential antiparasitic and antitumor agent. The chemical has a molecular weight of 341.16 g/mol and is described as a yellow solid. Research and studies on this chemical are ongoing to determine its potential therapeutic uses and effectiveness in various medical treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 549478-39-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,4,9,4,7 and 8 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 549478-39:
(8*5)+(7*4)+(6*9)+(5*4)+(4*7)+(3*8)+(2*3)+(1*9)=209
209 % 10 = 9
So 549478-39-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H10ClNO3S/c1-14-9(13)8-6(3-5-15-8)11-7(12)2-4-10/h3,5H,2,4H2,1H3,(H,11,12)